C22H27BrN2O2 — CID 55757962
5-(4-bromophenyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylpentanamide (PubChem CID 55757962) has the molecular formula C22H27BrN2O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylpentanamide.
| Compound Name | 5-(4-bromophenyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 55757962 |
| Molecular Formula | C22H27BrN2O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 5-(4-bromophenyl)-N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylpentanamide |
| SMILES | Cc1cccc(NC(=O)CN(C)C(=O)CCCCc2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C22H27BrN2O2/c1-16-7-6-9-20(17(16)2)24-21(26)15-25(3)22(27)10-5-4-8-18-11-13-19(23)14-12-18/h6-7,9,11-14H,4-5,8,10,15H2,1-3H3,(H,24,26) |
| InChIKey | AWPSITFYTKCSNY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|