C21H27Cl3N2 — CID 18538685
N-[3-(4-benzylpiperidin-1-yl)propyl]-3,4-dichloroaniline;hydrochloride (PubChem CID 18538685) has the molecular formula C21H27Cl3N2 and a molecular weight of 413.82 g/mol. Its IUPAC name is N-[3-(4-benzylpiperidin-1-yl)propyl]-3,4-dichloroaniline;hydrochloride.
| Compound Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-3,4-dichloroaniline;hydrochloride |
|---|---|
| PubChem CID | 18538685 |
| Molecular Formula | C21H27Cl3N2 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | N-[3-(4-benzylpiperidin-1-yl)propyl]-3,4-dichloroaniline;hydrochloride |
| SMILES | Cl.Clc1ccc(NCCCN2CCC(Cc3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C21H26Cl2N2.ClH/c22-20-8-7-19(16-21(20)23)24-11-4-12-25-13-9-18(10-14-25)15-17-5-2-1-3-6-17;/h1-3,5-8,16,18,24H,4,9-15H2;1H |
| InChIKey | RNLVAXXQJICUAB-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|