C24H36Cl2N2O2S — CID 18538584
3,4-dimethyl-N-[3-[4-[(4-methylsulfonylphenyl)methyl]piperidin-1-yl]propyl]aniline;dihydrochloride (PubChem CID 18538584) has the molecular formula C24H36Cl2N2O2S and a molecular weight of 487.54 g/mol. Its IUPAC name is 3,4-dimethyl-N-[3-[4-[(4-methylsulfonylphenyl)methyl]piperidin-1-yl]propyl]aniline;dihydrochloride.
| Compound Name | 3,4-dimethyl-N-[3-[4-[(4-methylsulfonylphenyl)methyl]piperidin-1-yl]propyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 18538584 |
| Molecular Formula | C24H36Cl2N2O2S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 3,4-dimethyl-N-[3-[4-[(4-methylsulfonylphenyl)methyl]piperidin-1-yl]propyl]aniline;dihydrochloride |
| SMILES | Cc1ccc(NCCCN2CCC(Cc3ccc(S(C)(=O)=O)cc3)CC2)cc1C.Cl.Cl |
| InChI | InChI=1S/C24H34N2O2S.2ClH/c1-19-5-8-23(17-20(19)2)25-13-4-14-26-15-11-22(12-16-26)18-21-6-9-24(10-7-21)29(3,27)28;;/h5-10,17,22,25H,4,11-16,18H2,1-3H3;2*1H |
| InChIKey | NHMUZIVVGQYEHK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|