C27H39N3O4S — CID 139986522
ethyl 2-[[4-[[1-(3-anilinopropyl)piperidin-4-yl]methyl]phenyl]sulfonylamino]-2-methylpropanoate (PubChem CID 139986522) has the molecular formula C27H39N3O4S and a molecular weight of 501.69 g/mol. Its IUPAC name is ethyl 2-[[4-[[1-(3-anilinopropyl)piperidin-4-yl]methyl]phenyl]sulfonylamino]-2-methylpropanoate.
| Compound Name | ethyl 2-[[4-[[1-(3-anilinopropyl)piperidin-4-yl]methyl]phenyl]sulfonylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 139986522 |
| Molecular Formula | C27H39N3O4S |
| Molecular Weight | 501.69 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | ethyl 2-[[4-[[1-(3-anilinopropyl)piperidin-4-yl]methyl]phenyl]sulfonylamino]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)NS(=O)(=O)c1ccc(CC2CCN(CCCNc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H39N3O4S/c1-4-34-26(31)27(2,3)29-35(32,33)25-13-11-22(12-14-25)21-23-15-19-30(20-16-23)18-8-17-28-24-9-6-5-7-10-24/h5-7,9-14,23,28-29H,4,8,15-21H2,1-3H3 |
| InChIKey | OJCNWNVQAWGZSH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|