C16H23Cl2N3S — CID 43076905
1-(3,4-dichlorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea (PubChem CID 43076905) has the molecular formula C16H23Cl2N3S and a molecular weight of 360.35 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 43076905 |
| Molecular Formula | C16H23Cl2N3S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea |
| SMILES | CC1CCCCN1C(C)CNC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H23Cl2N3S/c1-11-5-3-4-8-21(11)12(2)10-19-16(22)20-13-6-7-14(17)15(18)9-13/h6-7,9,11-12H,3-5,8,10H2,1-2H3,(H2,19,20,22) |
| InChIKey | LJOVEGNQIQUOKJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|