C16H24FN3S — CID 43076912
1-(4-fluorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea (PubChem CID 43076912) has the molecular formula C16H24FN3S and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 43076912 |
| Molecular Formula | C16H24FN3S |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea |
| SMILES | CC1CCCCN1C(C)CNC(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H24FN3S/c1-12-5-3-4-10-20(12)13(2)11-18-16(21)19-15-8-6-14(17)7-9-15/h6-9,12-13H,3-5,10-11H2,1-2H3,(H2,18,19,21) |
| InChIKey | ZMZKZQYXPQTEKA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|