C18H29N3S — CID 43076890
1-(2,5-dimethylphenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea (PubChem CID 43076890) has the molecular formula C18H29N3S and a molecular weight of 319.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 43076890 |
| Molecular Formula | C18H29N3S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[2-(2-methylpiperidin-1-yl)propyl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)NCC(C)N2CCCCC2C)c1 |
| InChI | InChI=1S/C18H29N3S/c1-13-8-9-14(2)17(11-13)20-18(22)19-12-16(4)21-10-6-5-7-15(21)3/h8-9,11,15-16H,5-7,10,12H2,1-4H3,(H2,19,20,22) |
| InChIKey | OGVHHCCEMJAVKX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|