C20H32N4O2 — CID 111381071
1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111381071) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111381071 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-3-[2-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)NCC(C)N1CCCCC1C |
| InChI | InChI=1S/C20H32N4O2/c1-15-6-4-5-11-24(15)16(2)13-23-20(21-3)22-10-9-17-7-8-18-19(12-17)26-14-25-18/h7-8,12,15-16H,4-6,9-11,13-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | TXVQWUGQBFRKGN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|