C18H28N4O3S — CID 109026393
N-(1,1-dioxothiolan-3-yl)-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide (PubChem CID 109026393) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide |
|---|---|
| PubChem CID | 109026393 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[4-(4-methylpiperazin-1-yl)anilino]propanamide |
| SMILES | CN1CCN(c2ccc(NCCC(=O)NC3CCS(=O)(=O)C3)cc2)CC1 |
| InChI | InChI=1S/C18H28N4O3S/c1-21-9-11-22(12-10-21)17-4-2-15(3-5-17)19-8-6-18(23)20-16-7-13-26(24,25)14-16/h2-5,16,19H,6-14H2,1H3,(H,20,23) |
| InChIKey | DBMAKSAFDAGLPX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|