C22H26FN3O2 — CID 108965494
3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-(4-methylphenyl)-3-oxopropanamide (PubChem CID 108965494) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-(4-methylphenyl)-3-oxopropanamide.
| Compound Name | 3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-(4-methylphenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108965494 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-(4-methylphenyl)-3-oxopropanamide |
| SMILES | Cc1ccc(NC(=O)C(C)(C)C(=O)N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C22H26FN3O2/c1-16-8-10-17(11-9-16)24-20(27)22(2,3)21(28)26-14-12-25(13-15-26)19-7-5-4-6-18(19)23/h4-11H,12-15H2,1-3H3,(H,24,27) |
| InChIKey | QABYZQGAZSMYPS-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|