C19H22ClN5O2 — CID 108965652
N-(4-chlorophenyl)-2,2-dimethyl-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide (PubChem CID 108965652) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,2-dimethyl-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide.
| Compound Name | N-(4-chlorophenyl)-2,2-dimethyl-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 108965652 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-(4-chlorophenyl)-2,2-dimethyl-3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propanamide |
| SMILES | CC(C)(C(=O)Nc1ccc(Cl)cc1)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-19(2,16(26)23-15-6-4-14(20)5-7-15)17(27)24-10-12-25(13-11-24)18-21-8-3-9-22-18/h3-9H,10-13H2,1-2H3,(H,23,26) |
| InChIKey | XJGSTVHJACSPGK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|