C23H28FN3O2 — CID 108963817
3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(2-phenylethyl)propanamide (PubChem CID 108963817) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(2-phenylethyl)propanamide.
| Compound Name | 3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 108963817 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 3-[4-(2-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-3-oxo-N-(2-phenylethyl)propanamide |
| SMILES | CC(C)(C(=O)NCCc1ccccc1)C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-23(2,21(28)25-13-12-18-8-4-3-5-9-18)22(29)27-16-14-26(15-17-27)20-11-7-6-10-19(20)24/h3-11H,12-17H2,1-2H3,(H,25,28) |
| InChIKey | LAPPGWLJJJFGTL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|