C22H28FN3O — CID 60509956
1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[methyl(3-phenylpropyl)amino]ethanone (PubChem CID 60509956) has the molecular formula C22H28FN3O and a molecular weight of 369.48 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[methyl(3-phenylpropyl)amino]ethanone.
| Compound Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[methyl(3-phenylpropyl)amino]ethanone |
|---|---|
| PubChem CID | 60509956 |
| Molecular Formula | C22H28FN3O |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-[4-(2-fluorophenyl)piperazin-1-yl]-2-[methyl(3-phenylpropyl)amino]ethanone |
| SMILES | CN(CCCc1ccccc1)CC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H28FN3O/c1-24(13-7-10-19-8-3-2-4-9-19)18-22(27)26-16-14-25(15-17-26)21-12-6-5-11-20(21)23/h2-6,8-9,11-12H,7,10,13-18H2,1H3 |
| InChIKey | MFEHDNNCESRZEQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |