C16H22FN3O3 — CID 119912513
2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]propanoic acid (PubChem CID 119912513) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]propanoic acid.
| Compound Name | 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 119912513 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)CC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C16H22FN3O3/c1-12(16(22)23)18(2)11-15(21)20-9-7-19(8-10-20)14-6-4-3-5-13(14)17/h3-6,12H,7-11H2,1-2H3,(H,22,23) |
| InChIKey | WTERFCOJGJRDSK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |