C18H27N3O2 — CID 108960695
2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxo-N-(2-phenylethyl)propanamide (PubChem CID 108960695) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxo-N-(2-phenylethyl)propanamide.
| Compound Name | 2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxo-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 108960695 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 2,2-dimethyl-3-(4-methylpiperazin-1-yl)-3-oxo-N-(2-phenylethyl)propanamide |
| SMILES | CN1CCN(C(=O)C(C)(C)C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O2/c1-18(2,17(23)21-13-11-20(3)12-14-21)16(22)19-10-9-15-7-5-4-6-8-15/h4-8H,9-14H2,1-3H3,(H,19,22) |
| InChIKey | OLYDAQCBKPTZKB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|