C23H28FN3O2 — CID 108961688
3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-oxopropanamide (PubChem CID 108961688) has the molecular formula C23H28FN3O2 and a molecular weight of 397.49 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-oxopropanamide.
| Compound Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 108961688 |
| Molecular Formula | C23H28FN3O2 |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 3-[4-(4-fluorophenyl)piperazin-1-yl]-2,2-dimethyl-N-[(2-methylphenyl)methyl]-3-oxopropanamide |
| SMILES | Cc1ccccc1CNC(=O)C(C)(C)C(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H28FN3O2/c1-17-6-4-5-7-18(17)16-25-21(28)23(2,3)22(29)27-14-12-26(13-15-27)20-10-8-19(24)9-11-20/h4-11H,12-16H2,1-3H3,(H,25,28) |
| InChIKey | FTHJTGJXRAYBDG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|