C29H28N4O6S — CID 43913451
ethyl 3-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-(4-benzoylpiperazin-1-yl)benzoate (PubChem CID 43913451) has the molecular formula C29H28N4O6S and a molecular weight of 560.63 g/mol. Its IUPAC name is ethyl 3-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-(4-benzoylpiperazin-1-yl)benzoate.
| Compound Name | ethyl 3-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-(4-benzoylpiperazin-1-yl)benzoate |
|---|---|
| PubChem CID | 43913451 |
| Molecular Formula | C29H28N4O6S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | ethyl 3-(1,3-benzodioxole-5-carbonylcarbamothioylamino)-4-(4-benzoylpiperazin-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=S)NC(=O)c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C29H28N4O6S/c1-2-37-28(36)21-8-10-23(32-12-14-33(15-13-32)27(35)19-6-4-3-5-7-19)22(16-21)30-29(40)31-26(34)20-9-11-24-25(17-20)39-18-38-24/h3-11,16-17H,2,12-15,18H2,1H3,(H2,30,31,34,40) |
| InChIKey | WXGBHAMFZZJIKJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|