C32H28N4O7 — CID 17092150
methyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate (PubChem CID 17092150) has the molecular formula C32H28N4O7 and a molecular weight of 580.60 g/mol. Its IUPAC name is methyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 17092150 |
| Molecular Formula | C32H28N4O7 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | methyl 4-(4-benzoylpiperazin-1-yl)-3-[[(E)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)c3ccccc3)CC2)c(NC(=O)/C=C/c2ccc(-c3ccccc3[N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C32H28N4O7/c1-42-32(39)23-11-14-28(34-17-19-35(20-18-34)31(38)22-7-3-2-4-8-22)26(21-23)33-30(37)16-13-24-12-15-29(43-24)25-9-5-6-10-27(25)36(40)41/h2-16,21H,17-20H2,1H3,(H,33,37)/b16-13+ |
| InChIKey | ITPFLZHBNXUVFL-DTQAZKPQSA-N |
| XLogP | 5.26 |
| TPSA | 135.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|