C31H27ClFN3O4 — CID 17092833
(E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17092833) has the molecular formula C31H27ClFN3O4 and a molecular weight of 560.03 g/mol. Its IUPAC name is (E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17092833 |
| Molecular Formula | C31H27ClFN3O4 |
| Molecular Weight | 560.03 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | (E)-N-[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-fluorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(c2ccc(NC(=O)/C=C/c3ccc(-c4ccc(F)cc4)o3)cc2)CC1 |
| InChI | InChI=1S/C31H27ClFN3O4/c1-39-29-13-4-22(32)20-27(29)31(38)36-18-16-35(17-19-36)25-9-7-24(8-10-25)34-30(37)15-12-26-11-14-28(40-26)21-2-5-23(33)6-3-21/h2-15,20H,16-19H2,1H3,(H,34,37)/b15-12+ |
| InChIKey | CQOVLOBRTDXZJW-NTCAYCPXSA-N |
| XLogP | 6.36 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.03 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|