C26H25ClN4O3S — CID 17336141
(E)-N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide (PubChem CID 17336141) has the molecular formula C26H25ClN4O3S and a molecular weight of 509.03 g/mol. Its IUPAC name is (E)-N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17336141 |
| Molecular Formula | C26H25ClN4O3S |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | (E)-N-[[4-(4-acetylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-(5-phenylfuran-2-yl)prop-2-enamide |
| SMILES | CC(=O)N1CCN(c2ccc(NC(=S)NC(=O)/C=C/c3ccc(-c4ccccc4)o3)cc2Cl)CC1 |
| InChI | InChI=1S/C26H25ClN4O3S/c1-18(32)30-13-15-31(16-14-30)23-10-7-20(17-22(23)27)28-26(35)29-25(33)12-9-21-8-11-24(34-21)19-5-3-2-4-6-19/h2-12,17H,13-16H2,1H3,(H2,28,29,33,35)/b12-9+ |
| InChIKey | GHIJMHANYHNITA-FMIVXFBMSA-N |
| XLogP | 4.79 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|