C28H29Cl2N3O3 — CID 21167962
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]prop-2-enamide (PubChem CID 21167962) has the molecular formula C28H29Cl2N3O3 and a molecular weight of 526.46 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 21167962 |
| Molecular Formula | C28H29Cl2N3O3 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[3-chloro-4-[4-(2-methylpropanoyl)piperazin-1-yl]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)Nc3ccc(N4CCN(C(=O)C(C)C)CC4)c(Cl)c3)o2)cc1Cl |
| InChI | InChI=1S/C28H29Cl2N3O3/c1-18(2)28(35)33-14-12-32(13-15-33)25-9-6-21(17-24(25)30)31-27(34)11-8-22-7-10-26(36-22)20-5-4-19(3)23(29)16-20/h4-11,16-18H,12-15H2,1-3H3,(H,31,34)/b11-8+ |
| InChIKey | OQFRYLAVHIHUOS-DHZHZOJOSA-N |
| XLogP | 6.52 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|