C20H18N3O5- — CID 7967401
4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]-2-methoxy-6-nitrophenolate (PubChem CID 7967401) has the molecular formula C20H18N3O5- and a molecular weight of 380.38 g/mol. Its IUPAC name is 4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 7967401 |
| Molecular Formula | C20H18N3O5- |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-[(E)-2-cyano-3-oxo-3-(2,4,6-trimethylanilino)prop-1-enyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2c(C)cc(C)cc2C)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C20H19N3O5/c1-11-5-12(2)18(13(3)6-11)22-20(25)15(10-21)7-14-8-16(23(26)27)19(24)17(9-14)28-4/h5-9,24H,1-4H3,(H,22,25)/p-1/b15-7+ |
| InChIKey | LMHWXYPIWNIKCE-VIZOYTHASA-M |
| XLogP | 3.15 |
| TPSA | 128.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|