C16H18N3O6- — CID 2094543
4-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate (PubChem CID 2094543) has the molecular formula C16H18N3O6- and a molecular weight of 348.34 g/mol. Its IUPAC name is 4-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 2094543 |
| Molecular Formula | C16H18N3O6- |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-[(E)-2-cyano-3-(3-ethoxypropylamino)-3-oxoprop-1-enyl]-2-methoxy-6-nitrophenolate |
| SMILES | CCOCCCNC(=O)/C(C#N)=C/c1cc(OC)c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N3O6/c1-3-25-6-4-5-18-16(21)12(10-17)7-11-8-13(19(22)23)15(20)14(9-11)24-2/h7-9,20H,3-6H2,1-2H3,(H,18,21)/p-1/b12-7+ |
| InChIKey | BPTJLCKGLOWYRQ-KPKJPENVSA-M |
| XLogP | 1.13 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|