C15H8Cl2FNO4 — CID 9042282
(E)-1-(2,6-dichloro-3-fluorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one (PubChem CID 9042282) has the molecular formula C15H8Cl2FNO4 and a molecular weight of 356.14 g/mol. Its IUPAC name is (E)-1-(2,6-dichloro-3-fluorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,6-dichloro-3-fluorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 9042282 |
| Molecular Formula | C15H8Cl2FNO4 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | (E)-1-(2,6-dichloro-3-fluorophenyl)-3-(4-hydroxy-3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)c([N+](=O)[O-])c1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C15H8Cl2FNO4/c16-9-3-4-10(18)15(17)14(9)13(21)6-2-8-1-5-12(20)11(7-8)19(22)23/h1-7,20H/b6-2+ |
| InChIKey | ULPRCCFXHBTZGG-QHHAFSJGSA-N |
| XLogP | 4.64 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|