C19H19ClO5 — CID 8832803
(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 8832803) has the molecular formula C19H19ClO5 and a molecular weight of 362.81 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8832803 |
| Molecular Formula | C19H19ClO5 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)-1-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc(OC)cc2OC)cc(Cl)c1O |
| InChI | InChI=1S/C19H19ClO5/c1-4-25-18-10-12(9-15(20)19(18)22)5-8-16(21)14-7-6-13(23-2)11-17(14)24-3/h5-11,22H,4H2,1-3H3/b8-5+ |
| InChIKey | LJFUZHQGEIOPPH-VMPITWQZSA-N |
| XLogP | 4.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|