C19H16ClNO4 — CID 9447495
2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]phenoxy]acetonitrile (PubChem CID 9447495) has the molecular formula C19H16ClNO4 and a molecular weight of 357.79 g/mol. Its IUPAC name is 2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 9447495 |
| Molecular Formula | C19H16ClNO4 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-[4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]phenoxy]acetonitrile |
| SMILES | CCOc1cc(/C=C/C(=O)c2ccc(OCC#N)cc2)cc(Cl)c1O |
| InChI | InChI=1S/C19H16ClNO4/c1-2-24-18-12-13(11-16(20)19(18)23)3-8-17(22)14-4-6-15(7-5-14)25-10-9-21/h3-8,11-12,23H,2,10H2,1H3/b8-3+ |
| InChIKey | LQZJDRLKETYBBC-FPYGCLRLSA-N |
| XLogP | 4.24 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|