C58H50O12 — CID 90887541
2,10-bis[6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]hexoxy]-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone (PubChem CID 90887541) has the molecular formula C58H50O12 and a molecular weight of 939.03 g/mol. Its IUPAC name is 2,10-bis[6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]hexoxy]-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone.
| Compound Name | 2,10-bis[6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]hexoxy]-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone |
|---|---|
| PubChem CID | 90887541 |
| Molecular Formula | C58H50O12 |
| Molecular Weight | 939.03 g/mol |
| Exact Mass | 938.33 |
| IUPAC Name | 2,10-bis[6-[4-(3-oxo-3-phenylprop-1-enyl)phenoxy]hexoxy]-6,15-dioxatetracyclo[9.7.0.04,17.08,13]octadeca-1(18),2,4(17),8(13),9,11-hexaene-5,7,14,16-tetrone |
| SMILES | O=C(C=Cc1ccc(OCCCCCCOc2cc3c4cc2-c2cc(c(cc2OCCCCCCOc2ccc(C=CC(=O)c5ccccc5)cc2)C(=O)OC3=O)C(=O)OC4=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C58H50O12/c59-51(41-15-7-5-8-16-41)29-23-39-19-25-43(26-20-39)65-31-11-1-3-13-33-67-53-37-49-47-35-45(53)46-36-48(56(62)69-55(47)61)50(58(64)70-57(49)63)38-54(46)68-34-14-4-2-12-32-66-44-27-21-40(22-28-44)24-30-52(60)42-17-9-6-10-18-42/h5-10,15-30,35-38H,1-4,11-14,31-34H2 |
| InChIKey | XSQXBOVYOPSWJR-UHFFFAOYSA-N |
| XLogP | 11.80 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.03 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|