C25H28O6 — CID 118030197
6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 3-oxo-3-phenylpropanoate (PubChem CID 118030197) has the molecular formula C25H28O6 and a molecular weight of 424.49 g/mol. Its IUPAC name is 6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 3-oxo-3-phenylpropanoate.
| Compound Name | 6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 3-oxo-3-phenylpropanoate |
|---|---|
| PubChem CID | 118030197 |
| Molecular Formula | C25H28O6 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 6-[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenoxy]hexyl 3-oxo-3-phenylpropanoate |
| SMILES | COC(=O)/C=C/c1ccc(OCCCCCCOC(=O)CC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28O6/c1-29-24(27)16-13-20-11-14-22(15-12-20)30-17-7-2-3-8-18-31-25(28)19-23(26)21-9-5-4-6-10-21/h4-6,9-16H,2-3,7-8,17-19H2,1H3/b16-13+ |
| InChIKey | BZGHTFWGGXMKHF-DTQAZKPQSA-N |
| XLogP | 4.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|