C54H74O12 — CID 54124536
methyl 3-[4-[7-[2,3-bis[7-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]heptoxy]propoxy]heptoxy]phenyl]prop-2-enoate (PubChem CID 54124536) has the molecular formula C54H74O12 and a molecular weight of 915.17 g/mol. Its IUPAC name is methyl 3-[4-[7-[2,3-bis[7-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]heptoxy]propoxy]heptoxy]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-[7-[2,3-bis[7-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]heptoxy]propoxy]heptoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54124536 |
| Molecular Formula | C54H74O12 |
| Molecular Weight | 915.17 g/mol |
| Exact Mass | 914.52 |
| IUPAC Name | methyl 3-[4-[7-[2,3-bis[7-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]heptoxy]propoxy]heptoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(OCCCCCCCOCC(COCCCCCCCOc2ccc(C=CC(=O)OC)cc2)OCCCCCCCOc2ccc(C=CC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C54H74O12/c1-58-52(55)34-25-45-19-28-48(29-20-45)63-39-15-9-4-7-13-37-61-43-51(66-42-18-12-6-11-17-41-65-50-32-23-47(24-33-50)27-36-54(57)60-3)44-62-38-14-8-5-10-16-40-64-49-30-21-46(22-31-49)26-35-53(56)59-2/h19-36,51H,4-18,37-44H2,1-3H3 |
| InChIKey | NQAPTDAIFMVZBV-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.17 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|