C51H68O12 — CID 18767093
methyl 2-[4-[6-[2,3-bis[6-[4-(3-methoxy-3-oxoprop-1-en-2-yl)phenoxy]hexoxy]propoxy]hexoxy]phenyl]prop-2-enoate (PubChem CID 18767093) has the molecular formula C51H68O12 and a molecular weight of 873.09 g/mol. Its IUPAC name is methyl 2-[4-[6-[2,3-bis[6-[4-(3-methoxy-3-oxoprop-1-en-2-yl)phenoxy]hexoxy]propoxy]hexoxy]phenyl]prop-2-enoate.
| Compound Name | methyl 2-[4-[6-[2,3-bis[6-[4-(3-methoxy-3-oxoprop-1-en-2-yl)phenoxy]hexoxy]propoxy]hexoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 18767093 |
| Molecular Formula | C51H68O12 |
| Molecular Weight | 873.09 g/mol |
| Exact Mass | 872.47 |
| IUPAC Name | methyl 2-[4-[6-[2,3-bis[6-[4-(3-methoxy-3-oxoprop-1-en-2-yl)phenoxy]hexoxy]propoxy]hexoxy]phenyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)c1ccc(OCCCCCCOCC(COCCCCCCOc2ccc(C(=C)C(=O)OC)cc2)OCCCCCCOc2ccc(C(=C)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C51H68O12/c1-39(49(52)55-4)42-19-25-45(26-20-42)60-33-15-9-7-13-31-58-37-48(63-36-18-12-11-17-35-62-47-29-23-44(24-30-47)41(3)51(54)57-6)38-59-32-14-8-10-16-34-61-46-27-21-43(22-28-46)40(2)50(53)56-5/h19-30,48H,1-3,7-18,31-38H2,4-6H3 |
| InChIKey | BOHUHDPICBUJHP-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.09 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|