C54H71F3O9 — CID 18767070
8-[2,3-bis[8-[2-(4-fluorophenyl)prop-2-enoyloxy]octoxy]propoxy]octyl 2-(4-fluorophenyl)prop-2-enoate (PubChem CID 18767070) has the molecular formula C54H71F3O9 and a molecular weight of 921.15 g/mol. Its IUPAC name is 8-[2,3-bis[8-[2-(4-fluorophenyl)prop-2-enoyloxy]octoxy]propoxy]octyl 2-(4-fluorophenyl)prop-2-enoate.
| Compound Name | 8-[2,3-bis[8-[2-(4-fluorophenyl)prop-2-enoyloxy]octoxy]propoxy]octyl 2-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18767070 |
| Molecular Formula | C54H71F3O9 |
| Molecular Weight | 921.15 g/mol |
| Exact Mass | 920.51 |
| IUPAC Name | 8-[2,3-bis[8-[2-(4-fluorophenyl)prop-2-enoyloxy]octoxy]propoxy]octyl 2-(4-fluorophenyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCCCCCCCOCC(COCCCCCCCCOC(=O)C(=C)c1ccc(F)cc1)OCCCCCCCCOC(=O)C(=C)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C54H71F3O9/c1-42(45-22-28-48(55)29-23-45)52(58)64-37-19-13-6-4-10-16-34-61-40-51(63-36-18-12-8-9-15-21-39-66-54(60)44(3)47-26-32-50(57)33-27-47)41-62-35-17-11-5-7-14-20-38-65-53(59)43(2)46-24-30-49(56)31-25-46/h22-33,51H,1-21,34-41H2 |
| InChIKey | PJAYNRKZWCKZEB-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.15 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|