C63H83N3O9 — CID 18767125
10-[2,3-bis[10-[2-(4-cyanophenyl)prop-2-enoyloxy]decoxy]propoxy]decyl 2-(4-cyanophenyl)prop-2-enoate (PubChem CID 18767125) has the molecular formula C63H83N3O9 and a molecular weight of 1026.37 g/mol. Its IUPAC name is 10-[2,3-bis[10-[2-(4-cyanophenyl)prop-2-enoyloxy]decoxy]propoxy]decyl 2-(4-cyanophenyl)prop-2-enoate.
| Compound Name | 10-[2,3-bis[10-[2-(4-cyanophenyl)prop-2-enoyloxy]decoxy]propoxy]decyl 2-(4-cyanophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 18767125 |
| Molecular Formula | C63H83N3O9 |
| Molecular Weight | 1026.37 g/mol |
| Exact Mass | 1025.61 |
| IUPAC Name | 10-[2,3-bis[10-[2-(4-cyanophenyl)prop-2-enoyloxy]decoxy]propoxy]decyl 2-(4-cyanophenyl)prop-2-enoate |
| SMILES | C=C(C(=O)OCCCCCCCCCCOCC(COCCCCCCCCCCOC(=O)C(=C)c1ccc(C#N)cc1)OCCCCCCCCCCOC(=O)C(=C)c1ccc(C#N)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C63H83N3O9/c1-51(57-34-28-54(46-64)29-35-57)61(67)73-43-25-19-13-6-4-10-16-22-40-70-49-60(72-42-24-18-12-8-9-15-21-27-45-75-63(69)53(3)59-38-32-56(48-66)33-39-59)50-71-41-23-17-11-5-7-14-20-26-44-74-62(68)52(2)58-36-30-55(47-65)31-37-58/h28-39,60H,1-27,40-45,49-50H2 |
| InChIKey | DUQCQQWBASZRDL-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 177.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1026.37 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|