C30H42F2O4 — CID 67785437
[4-(3-butoxy-1,1-difluoropropan-2-yl)phenyl] 4-decoxybenzoate (PubChem CID 67785437) has the molecular formula C30H42F2O4 and a molecular weight of 504.66 g/mol. Its IUPAC name is [4-(3-butoxy-1,1-difluoropropan-2-yl)phenyl] 4-decoxybenzoate.
| Compound Name | [4-(3-butoxy-1,1-difluoropropan-2-yl)phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 67785437 |
| Molecular Formula | C30H42F2O4 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | [4-(3-butoxy-1,1-difluoropropan-2-yl)phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(C(COCCCC)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H42F2O4/c1-3-5-7-8-9-10-11-12-22-35-26-17-15-25(16-18-26)30(33)36-27-19-13-24(14-20-27)28(29(31)32)23-34-21-6-4-2/h13-20,28-29H,3-12,21-23H2,1-2H3 |
| InChIKey | MTKQEBDVDWWLRW-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|