C29H38F2O4 — CID 139687731
[4-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-[(Z,2R)-non-3-en-2-yl]oxybenzoate (PubChem CID 139687731) has the molecular formula C29H38F2O4 and a molecular weight of 488.62 g/mol. Its IUPAC name is [4-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-[(Z,2R)-non-3-en-2-yl]oxybenzoate.
| Compound Name | [4-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-[(Z,2R)-non-3-en-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 139687731 |
| Molecular Formula | C29H38F2O4 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | [4-[(2R)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-[(Z,2R)-non-3-en-2-yl]oxybenzoate |
| SMILES | CCCCC/C=C\[C@@H](C)Oc1ccc(C(=O)Oc2ccc([C@H](COCCCC)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H38F2O4/c1-4-6-8-9-10-11-22(3)34-25-18-14-24(15-19-25)29(32)35-26-16-12-23(13-17-26)27(28(30)31)21-33-20-7-5-2/h10-19,22,27-28H,4-9,20-21H2,1-3H3/b11-10-/t22-,27+/m1/s1 |
| InChIKey | YVPNDOPQVYYPDM-CIIZHSHYSA-N |
| XLogP | 7.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|