C40H54F2O4 — CID 139687762
[4-[4-[(2R)-1,1-difluoro-3-[(2R)-octan-2-yl]oxypropan-2-yl]phenyl]phenyl] 4-decoxybenzoate (PubChem CID 139687762) has the molecular formula C40H54F2O4 and a molecular weight of 636.86 g/mol. Its IUPAC name is [4-[4-[(2R)-1,1-difluoro-3-[(2R)-octan-2-yl]oxypropan-2-yl]phenyl]phenyl] 4-decoxybenzoate.
| Compound Name | [4-[4-[(2R)-1,1-difluoro-3-[(2R)-octan-2-yl]oxypropan-2-yl]phenyl]phenyl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 139687762 |
| Molecular Formula | C40H54F2O4 |
| Molecular Weight | 636.86 g/mol |
| Exact Mass | 636.40 |
| IUPAC Name | [4-[4-[(2R)-1,1-difluoro-3-[(2R)-octan-2-yl]oxypropan-2-yl]phenyl]phenyl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc([C@H](CO[C@H](C)CCCCCC)C(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H54F2O4/c1-4-6-8-10-11-12-13-15-29-44-36-25-23-35(24-26-36)40(43)46-37-27-21-33(22-28-37)32-17-19-34(20-18-32)38(39(41)42)30-45-31(3)16-14-9-7-5-2/h17-28,31,38-39H,4-16,29-30H2,1-3H3/t31-,38+/m1/s1 |
| InChIKey | BIDGTTZZQMWHTQ-YSJGZBICSA-N |
| XLogP | 11.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.86 |
| LogP ≤ 5 | 11.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|