C35H44F2O4 — CID 139649994
[4-[(2S)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-(4-nonan-2-yloxyphenyl)benzoate (PubChem CID 139649994) has the molecular formula C35H44F2O4 and a molecular weight of 566.73 g/mol. Its IUPAC name is [4-[(2S)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-(4-nonan-2-yloxyphenyl)benzoate.
| Compound Name | [4-[(2S)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-(4-nonan-2-yloxyphenyl)benzoate |
|---|---|
| PubChem CID | 139649994 |
| Molecular Formula | C35H44F2O4 |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | [4-[(2S)-3-butoxy-1,1-difluoropropan-2-yl]phenyl] 4-(4-nonan-2-yloxyphenyl)benzoate |
| SMILES | CCCCCCCC(C)Oc1ccc(-c2ccc(C(=O)Oc3ccc([C@@H](COCCCC)C(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H44F2O4/c1-4-6-8-9-10-11-26(3)40-31-20-16-28(17-21-31)27-12-14-30(15-13-27)35(38)41-32-22-18-29(19-23-32)33(34(36)37)25-39-24-7-5-2/h12-23,26,33-34H,4-11,24-25H2,1-3H3/t26?,33-/m1/s1 |
| InChIKey | LBZYTWGWAVPQRB-NXDCZNQUSA-N |
| XLogP | 9.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|