C28H36F2O5 — CID 139687734
[4-[(2R)-1,1-difluoro-3-oxo-3-propan-2-yloxypropan-2-yl]phenyl] 4-[(2S)-nonan-2-yl]oxybenzoate (PubChem CID 139687734) has the molecular formula C28H36F2O5 and a molecular weight of 490.59 g/mol. Its IUPAC name is [4-[(2R)-1,1-difluoro-3-oxo-3-propan-2-yloxypropan-2-yl]phenyl] 4-[(2S)-nonan-2-yl]oxybenzoate.
| Compound Name | [4-[(2R)-1,1-difluoro-3-oxo-3-propan-2-yloxypropan-2-yl]phenyl] 4-[(2S)-nonan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 139687734 |
| Molecular Formula | C28H36F2O5 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [4-[(2R)-1,1-difluoro-3-oxo-3-propan-2-yloxypropan-2-yl]phenyl] 4-[(2S)-nonan-2-yl]oxybenzoate |
| SMILES | CCCCCCC[C@H](C)Oc1ccc(C(=O)Oc2ccc([C@H](C(=O)OC(C)C)C(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H36F2O5/c1-5-6-7-8-9-10-20(4)34-23-17-13-22(14-18-23)27(31)35-24-15-11-21(12-16-24)25(26(29)30)28(32)33-19(2)3/h11-20,25-26H,5-10H2,1-4H3/t20-,25-/m0/s1 |
| InChIKey | FGJQWBOARCNTJQ-CPJSRVTESA-N |
| XLogP | 7.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|