About [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate
[4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate (PubChem CID 19880053) has the molecular formula C28H40O5
and a molecular weight of 456.62 g/mol. Its IUPAC name is [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate.
Molecular Properties
| Compound Name | [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate |
| PubChem CID | 19880053 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Oc2ccc(OCCC(C)OCCCCC)cc2)cc1 |
| InChI | InChI=1S/C28H40O5/c1-4-6-8-10-21-31-25-13-11-24(12-14-25)28(29)33-27-17-15-26(16-18-27)32-22-19-23(3)30-20-9-7-5-2/h11-18,23H,4-10,19-22H2,1-3H3 |
| InChIKey | ZOAMFTHZRRUQJX-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate?
The IUPAC name of [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate (CID 19880053) is [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate.
What is the SMILES notation for [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate?
The canonical SMILES for [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate is CCCCCCOc1ccc(C(=O)Oc2ccc(OCCC(C)OCCCCC)cc2)cc1.
What is the InChIKey of [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate?
The InChIKey is ZOAMFTHZRRUQJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H40O5/c1-4-6-8-10-21-31-25-13-11-24(12-14-25)28(29)33-27-17-15-26(16-18-27)32-22-19-23(3)30-20-9-7-5-2/h11-18,23H,4-10,19-22H2,1-3H3.
What are the key properties of [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate?
[4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate has a molecular weight of 456.62 g/mol, XLogP of 7.23, 17 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3-pentoxybutoxy)phenyl] 4-hexoxybenzoate is sourced from PubChem (CID 19880053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).