C28H44O5 — CID 123802501
6-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]hexyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123802501) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is 6-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]hexyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 6-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]hexyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123802501 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 6-[4-(3-methoxy-3-oxoprop-1-enyl)phenoxy]hexyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | COC(=O)C=Cc1ccc(OCCCCCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C28H44O5/c1-26(2,3)21-28(7,27(4,5)6)25(30)33-20-12-10-9-11-19-32-23-16-13-22(14-17-23)15-18-24(29)31-8/h13-18H,9-12,19-21H2,1-8H3 |
| InChIKey | DDOJVIWUUOAQDS-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|