C29H46O4 — CID 155085430
6-[4-[(E)-3-oxoprop-1-enyl]phenoxy]hexyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate (PubChem CID 155085430) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is 6-[4-[(E)-3-oxoprop-1-enyl]phenoxy]hexyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate.
| Compound Name | 6-[4-[(E)-3-oxoprop-1-enyl]phenoxy]hexyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 155085430 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | 6-[4-[(E)-3-oxoprop-1-enyl]phenoxy]hexyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate |
| SMILES | CC(C)C(C)(C)CC(C)(C(=O)OCCCCCCOc1ccc(/C=C/C=O)cc1)C(C)(C)C |
| InChI | InChI=1S/C29H46O4/c1-23(2)28(6,7)22-29(8,27(3,4)5)26(31)33-21-12-10-9-11-20-32-25-17-15-24(16-18-25)14-13-19-30/h13-19,23H,9-12,20-22H2,1-8H3/b14-13+ |
| InChIKey | DHMAHQHTWHTJDQ-BUHFOSPRSA-N |
| XLogP | 7.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|