C31H50O4 — CID 137491175
8-[4-[(E)-3-oxoprop-1-enyl]phenoxy]octyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate (PubChem CID 137491175) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is 8-[4-[(E)-3-oxoprop-1-enyl]phenoxy]octyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate.
| Compound Name | 8-[4-[(E)-3-oxoprop-1-enyl]phenoxy]octyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 137491175 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | 8-[4-[(E)-3-oxoprop-1-enyl]phenoxy]octyl 2-tert-butyl-2,4,4,5-tetramethylhexanoate |
| SMILES | CC(C)C(C)(C)CC(C)(C(=O)OCCCCCCCCOc1ccc(/C=C/C=O)cc1)C(C)(C)C |
| InChI | InChI=1S/C31H50O4/c1-25(2)30(6,7)24-31(8,29(3,4)5)28(33)35-23-14-12-10-9-11-13-22-34-27-19-17-26(18-20-27)16-15-21-32/h15-21,25H,9-14,22-24H2,1-8H3/b16-15+ |
| InChIKey | ONLFWOTXHNYQIH-FOCLMDBBSA-N |
| XLogP | 8.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|