C33H47NO3 — CID 167024621
10-[4-[[(E)-3-(4-methylphenyl)prop-2-enylidene]amino]phenoxy]decyl 3,3-dimethylpentanoate (PubChem CID 167024621) has the molecular formula C33H47NO3 and a molecular weight of 505.74 g/mol. Its IUPAC name is 10-[4-[[(E)-3-(4-methylphenyl)prop-2-enylidene]amino]phenoxy]decyl 3,3-dimethylpentanoate.
| Compound Name | 10-[4-[[(E)-3-(4-methylphenyl)prop-2-enylidene]amino]phenoxy]decyl 3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 167024621 |
| Molecular Formula | C33H47NO3 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.36 |
| IUPAC Name | 10-[4-[[(E)-3-(4-methylphenyl)prop-2-enylidene]amino]phenoxy]decyl 3,3-dimethylpentanoate |
| SMILES | CCC(C)(C)CC(=O)OCCCCCCCCCCOc1ccc(/N=C/C=C/c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C33H47NO3/c1-5-33(3,4)27-32(35)37-26-13-11-9-7-6-8-10-12-25-36-31-22-20-30(21-23-31)34-24-14-15-29-18-16-28(2)17-19-29/h14-24H,5-13,25-27H2,1-4H3/b15-14+,34-24+ |
| InChIKey | GWUGHPRMSQRNDV-QAPWVKMNSA-N |
| XLogP | 9.28 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|