C46H48N2O6 — CID 102065161
bis[5-[4-[(4-methylphenyl)iminomethyl]phenoxy]pentyl] benzene-1,2-dicarboxylate (PubChem CID 102065161) has the molecular formula C46H48N2O6 and a molecular weight of 724.90 g/mol. Its IUPAC name is bis[5-[4-[(4-methylphenyl)iminomethyl]phenoxy]pentyl] benzene-1,2-dicarboxylate.
| Compound Name | bis[5-[4-[(4-methylphenyl)iminomethyl]phenoxy]pentyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102065161 |
| Molecular Formula | C46H48N2O6 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.35 |
| IUPAC Name | bis[5-[4-[(4-methylphenyl)iminomethyl]phenoxy]pentyl] benzene-1,2-dicarboxylate |
| SMILES | Cc1ccc(/N=C/c2ccc(OCCCCCOC(=O)c3ccccc3C(=O)OCCCCCOc3ccc(/C=N/c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H48N2O6/c1-35-13-21-39(22-14-35)47-33-37-17-25-41(26-18-37)51-29-7-3-9-31-53-45(49)43-11-5-6-12-44(43)46(50)54-32-10-4-8-30-52-42-27-19-38(20-28-42)34-48-40-23-15-36(2)16-24-40/h5-6,11-28,33-34H,3-4,7-10,29-32H2,1-2H3/b47-33+,48-34+ |
| InChIKey | GGBLJMQHKXBNCI-YZYHKDCPSA-N |
| XLogP | 10.62 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|