C31H46O7 — CID 102076685
tributyl 3-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pentane-1,3,5-tricarboxylate (PubChem CID 102076685) has the molecular formula C31H46O7 and a molecular weight of 530.70 g/mol. Its IUPAC name is tributyl 3-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pentane-1,3,5-tricarboxylate.
| Compound Name | tributyl 3-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pentane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 102076685 |
| Molecular Formula | C31H46O7 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | tributyl 3-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pentane-1,3,5-tricarboxylate |
| SMILES | CCCCOC(=O)CCC(/C=C/C=C/c1ccc(OC)cc1)(CCC(=O)OCCCC)C(=O)OCCCC |
| InChI | InChI=1S/C31H46O7/c1-5-8-23-36-28(32)18-21-31(30(34)38-25-10-7-3,22-19-29(33)37-24-9-6-2)20-12-11-13-26-14-16-27(35-4)17-15-26/h11-17,20H,5-10,18-19,21-25H2,1-4H3/b13-11+,20-12+ |
| InChIKey | AIXFJVLHXWNZTN-SUZRTUOYSA-N |
| XLogP | 6.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|