C23H34O5 — CID 68761633
2-butoxycarbonyl-2-tert-butyl-5-(4-methoxyphenyl)-3,3-dimethylpent-4-enoic acid (PubChem CID 68761633) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-butoxycarbonyl-2-tert-butyl-5-(4-methoxyphenyl)-3,3-dimethylpent-4-enoic acid.
| Compound Name | 2-butoxycarbonyl-2-tert-butyl-5-(4-methoxyphenyl)-3,3-dimethylpent-4-enoic acid |
|---|---|
| PubChem CID | 68761633 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-butoxycarbonyl-2-tert-butyl-5-(4-methoxyphenyl)-3,3-dimethylpent-4-enoic acid |
| SMILES | CCCCOC(=O)C(C(=O)O)(C(C)(C)C)C(C)(C)C=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H34O5/c1-8-9-16-28-20(26)23(19(24)25,21(2,3)4)22(5,6)15-14-17-10-12-18(27-7)13-11-17/h10-15H,8-9,16H2,1-7H3,(H,24,25) |
| InChIKey | PLXZWGRATPDNKM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|