C17H26O3 — CID 67944883
1-methoxy-4-[(E)-prop-1-enyl]benzene;pentyl acetate (PubChem CID 67944883) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-prop-1-enyl]benzene;pentyl acetate.
| Compound Name | 1-methoxy-4-[(E)-prop-1-enyl]benzene;pentyl acetate |
|---|---|
| PubChem CID | 67944883 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-methoxy-4-[(E)-prop-1-enyl]benzene;pentyl acetate |
| SMILES | C/C=C/c1ccc(OC)cc1.CCCCCOC(C)=O |
| InChI | InChI=1S/C10H12O.C7H14O2/c1-3-4-9-5-7-10(11-2)8-6-9;1-3-4-5-6-9-7(2)8/h3-8H,1-2H3;3-6H2,1-2H3/b4-3+; |
| InChIKey | HQALYNFKMYKTRU-BJILWQEISA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|