C21H31FO3 — CID 59638882
10-(2-fluoro-4-prop-1-enylphenoxy)decyl acetate (PubChem CID 59638882) has the molecular formula C21H31FO3 and a molecular weight of 350.47 g/mol. Its IUPAC name is 10-(2-fluoro-4-prop-1-enylphenoxy)decyl acetate.
| Compound Name | 10-(2-fluoro-4-prop-1-enylphenoxy)decyl acetate |
|---|---|
| PubChem CID | 59638882 |
| Molecular Formula | C21H31FO3 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 10-(2-fluoro-4-prop-1-enylphenoxy)decyl acetate |
| SMILES | CC=Cc1ccc(OCCCCCCCCCCOC(C)=O)c(F)c1 |
| InChI | InChI=1S/C21H31FO3/c1-3-12-19-13-14-21(20(22)17-19)25-16-11-9-7-5-4-6-8-10-15-24-18(2)23/h3,12-14,17H,4-11,15-16H2,1-2H3 |
| InChIKey | JYAGZGFQDGQSCK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|