About 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene
1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene (PubChem CID 144942641) has the molecular formula C20H28O2
and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene.
Molecular Properties
| Compound Name | 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene |
| PubChem CID | 144942641 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene |
| SMILES | C=C(C)C(=C)OCCCCCCOc1ccc(/C=C/C)cc1 |
| InChI | InChI=1S/C20H28O2/c1-5-10-19-11-13-20(14-12-19)22-16-9-7-6-8-15-21-18(4)17(2)3/h5,10-14H,2,4,6-9,15-16H2,1,3H3/b10-5+ |
| InChIKey | VTGONXNHXYEZGL-BJMVGYQFSA-N |
| XLogP | 5.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene?
The IUPAC name of 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene (CID 144942641) is 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene.
What is the SMILES notation for 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene?
The canonical SMILES for 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene is C=C(C)C(=C)OCCCCCCOc1ccc(/C=C/C)cc1.
What is the InChIKey of 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene?
The InChIKey is VTGONXNHXYEZGL-BJMVGYQFSA-N. The full InChI is InChI=1S/C20H28O2/c1-5-10-19-11-13-20(14-12-19)22-16-9-7-6-8-15-21-18(4)17(2)3/h5,10-14H,2,4,6-9,15-16H2,1,3H3/b10-5+.
What are the key properties of 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene?
1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene has a molecular weight of 300.44 g/mol, XLogP of 5.77, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(3-methylbuta-1,3-dien-2-yloxy)hexoxy]-4-[(E)-prop-1-enyl]benzene is sourced from PubChem (CID 144942641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).