About 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate
3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate (PubChem CID 159554839) has the molecular formula C16H22O5
and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate |
| PubChem CID | 159554839 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate |
| SMILES | CCCOC(=O)CC.COc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C10H10O3.C6H12O2/c1-13-9-5-2-8(3-6-9)4-7-10(11)12;1-3-5-8-6(7)4-2/h2-7H,1H3,(H,11,12);3-5H2,1-2H3 |
| InChIKey | MFVVZVSZQNBMKI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate?
The IUPAC name of 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate (CID 159554839) is 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate.
What is the SMILES notation for 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate?
The canonical SMILES for 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate is CCCOC(=O)CC.COc1ccc(C=CC(=O)O)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate?
The InChIKey is MFVVZVSZQNBMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3.C6H12O2/c1-13-9-5-2-8(3-6-9)4-7-10(11)12;1-3-5-8-6(7)4-2/h2-7H,1H3,(H,11,12);3-5H2,1-2H3.
What are the key properties of 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate?
3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate has a molecular weight of 294.35 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)prop-2-enoic acid;propyl propanoate is sourced from PubChem (CID 159554839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).