C37H49F3O8 — CID 146600292
[2-methoxy-4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenyl] 4-[6-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyhexoxy]benzoate (PubChem CID 146600292) has the molecular formula C37H49F3O8 and a molecular weight of 678.79 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenyl] 4-[6-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyhexoxy]benzoate.
| Compound Name | [2-methoxy-4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenyl] 4-[6-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyhexoxy]benzoate |
|---|---|
| PubChem CID | 146600292 |
| Molecular Formula | C37H49F3O8 |
| Molecular Weight | 678.79 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | [2-methoxy-4-[(E)-3-oxo-3-(2,2,2-trifluoroethoxy)prop-1-enyl]phenyl] 4-[6-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyhexoxy]benzoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(F)(F)F)ccc1OC(=O)c1ccc(OCCCCCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C37H49F3O8/c1-34(2,3)24-36(7,35(4,5)6)33(43)46-22-12-10-9-11-21-45-28-17-15-27(16-18-28)32(42)48-29-19-13-26(23-30(29)44-8)14-20-31(41)47-25-37(38,39)40/h13-20,23H,9-12,21-22,24-25H2,1-8H3/b20-14+ |
| InChIKey | DQTVNUMDAPVTHZ-XSFVSMFZSA-N |
| XLogP | 9.00 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.79 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|